C27H31Cl4N4+ — CID 25066244
(2E)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-methylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-5,6-dichloro-3-methylbenzimidazole (PubChem CID 25066244) has the molecular formula C27H31Cl4N4+ and a molecular weight of 553.39 g/mol. Its IUPAC name is (2E)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-methylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-5,6-dichloro-3-methylbenzimidazole.
| Compound Name | (2E)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-methylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-5,6-dichloro-3-methylbenzimidazole |
|---|---|
| PubChem CID | 25066244 |
| Molecular Formula | C27H31Cl4N4+ |
| Molecular Weight | 553.39 g/mol |
| Exact Mass | 551.13 |
| IUPAC Name | (2E)-1-butyl-2-[(E)-3-(1-butyl-5,6-dichloro-3-methylbenzimidazol-3-ium-2-yl)prop-2-enylidene]-5,6-dichloro-3-methylbenzimidazole |
| SMILES | CCCCN1/C(=C/C=C/c2n(CCCC)c3cc(Cl)c(Cl)cc3[n+]2C)N(C)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C27H31Cl4N4/c1-5-7-12-34-24-16-20(30)18(28)14-22(24)32(3)26(34)10-9-11-27-33(4)23-15-19(29)21(31)17-25(23)35(27)13-8-6-2/h9-11,14-17H,5-8,12-13H2,1-4H3/q+1 |
| InChIKey | KKNWGHWOVJLOFM-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.39 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|