C30H31FN4O3S — CID 59957800
3-[2-[(E,3E)-3-(3-ethyl-1-methyl-5-phenylbenzimidazol-2-ylidene)prop-1-enyl]-6-fluoro-3-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonate (PubChem CID 59957800) has the molecular formula C30H31FN4O3S and a molecular weight of 546.67 g/mol. Its IUPAC name is 3-[2-[(E,3E)-3-(3-ethyl-1-methyl-5-phenylbenzimidazol-2-ylidene)prop-1-enyl]-6-fluoro-3-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E,3E)-3-(3-ethyl-1-methyl-5-phenylbenzimidazol-2-ylidene)prop-1-enyl]-6-fluoro-3-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59957800 |
| Molecular Formula | C30H31FN4O3S |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3-[2-[(E,3E)-3-(3-ethyl-1-methyl-5-phenylbenzimidazol-2-ylidene)prop-1-enyl]-6-fluoro-3-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonate |
| SMILES | CCN1/C(=C/C=C/c2n(CCCS(=O)(=O)[O-])c3cc(F)ccc3[n+]2C)N(C)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C30H31FN4O3S/c1-4-34-27-20-23(22-10-6-5-7-11-22)14-16-25(27)32(2)29(34)12-8-13-30-33(3)26-17-15-24(31)21-28(26)35(30)18-9-19-39(36,37)38/h5-8,10-17,20-21H,4,9,18-19H2,1-3H3 |
| InChIKey | VCNLWXNOSVAEFA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 72.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|