C31H36N6O6S2 — CID 137241656
4-[(2Z)-6-cyano-2-[(Z)-3-[5-cyano-1-ethyl-3-(4-sulfobutyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonate (PubChem CID 137241656) has the molecular formula C31H36N6O6S2 and a molecular weight of 652.80 g/mol. Its IUPAC name is 4-[(2Z)-6-cyano-2-[(Z)-3-[5-cyano-1-ethyl-3-(4-sulfobutyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonate.
| Compound Name | 4-[(2Z)-6-cyano-2-[(Z)-3-[5-cyano-1-ethyl-3-(4-sulfobutyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 137241656 |
| Molecular Formula | C31H36N6O6S2 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 4-[(2Z)-6-cyano-2-[(Z)-3-[5-cyano-1-ethyl-3-(4-sulfobutyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-3-ethylbenzimidazol-1-yl]butane-1-sulfonate |
| SMILES | CCN1/C(=C/C=C\c2n(CCCCS(=O)(=O)O)c3cc(C#N)ccc3[n+]2CC)N(CCCCS(=O)(=O)[O-])c2cc(C#N)ccc21 |
| InChI | InChI=1S/C31H36N6O6S2/c1-3-34-26-14-12-24(22-32)20-28(26)36(16-5-7-18-44(38,39)40)30(34)10-9-11-31-35(4-2)27-15-13-25(23-33)21-29(27)37(31)17-6-8-19-45(41,42)43/h9-15,20-21H,3-8,16-19H2,1-2H3,(H-,38,39,40,41,42,43) |
| InChIKey | YDDFKHHBNJWFEZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 174.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|