C27H29F6IN4 — CID 178184549
2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole iodide (PubChem CID 178184549) has the molecular formula C27H29F6IN4 and a molecular weight of 650.45 g/mol. Its IUPAC name is 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole iodide.
| Compound Name | 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole iodide |
|---|---|
| PubChem CID | 178184549 |
| Molecular Formula | C27H29F6IN4 |
| Molecular Weight | 650.45 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole iodide |
| SMILES | CCN1C(=CC=Cc2n(CC)c3cc(C(F)(F)F)ccc3[n+]2CC)N(CC)c2cc(C(F)(F)F)ccc21.[I-] |
| InChI | InChI=1S/C27H29F6N4.HI/c1-5-34-20-14-12-18(26(28,29)30)16-22(20)36(7-3)24(34)10-9-11-25-35(6-2)21-15-13-19(27(31,32)33)17-23(21)37(25)8-4;/h9-17H,5-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | CYDALYHNOUWBDW-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|