C31H38F3N4O4S+ — CID 59937539
3-[2-[(1E,3Z,5E)-5-[1,3-diethyl-5-(trifluoromethoxy)benzimidazol-2-ylidene]-3-methylpenta-1,3-dienyl]-3-ethyl-6-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid (PubChem CID 59937539) has the molecular formula C31H38F3N4O4S+ and a molecular weight of 619.73 g/mol. Its IUPAC name is 3-[2-[(1E,3Z,5E)-5-[1,3-diethyl-5-(trifluoromethoxy)benzimidazol-2-ylidene]-3-methylpenta-1,3-dienyl]-3-ethyl-6-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1E,3Z,5E)-5-[1,3-diethyl-5-(trifluoromethoxy)benzimidazol-2-ylidene]-3-methylpenta-1,3-dienyl]-3-ethyl-6-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59937539 |
| Molecular Formula | C31H38F3N4O4S+ |
| Molecular Weight | 619.73 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 3-[2-[(1E,3Z,5E)-5-[1,3-diethyl-5-(trifluoromethoxy)benzimidazol-2-ylidene]-3-methylpenta-1,3-dienyl]-3-ethyl-6-methylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C\C=C(C)/C=C/c2n(CCCS(=O)(=O)O)c3cc(C)ccc3[n+]2CC)N(CC)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C31H37F3N4O4S/c1-6-35-26-15-13-24(42-31(32,33)34)21-28(26)37(8-3)29(35)16-11-22(4)12-17-30-36(7-2)25-14-10-23(5)20-27(25)38(30)18-9-19-43(39,40)41/h10-17,20-21H,6-9,18-19H2,1-5H3/p+1 |
| InChIKey | DWBJGGGQYZSHHQ-UHFFFAOYSA-O |
| XLogP | 6.60 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|