C31H37N6O2+ — CID 3934907
2-[3-[5-cyano-3-(2-ethoxyethyl)-1-ethylbenzimidazol-1-ium-2-yl]prop-2-enylidene]-3-(2-ethoxyethyl)-1-ethylbenzimidazole-5-carbonitrile (PubChem CID 3934907) has the molecular formula C31H37N6O2+ and a molecular weight of 525.68 g/mol. Its IUPAC name is 2-[3-[5-cyano-3-(2-ethoxyethyl)-1-ethylbenzimidazol-1-ium-2-yl]prop-2-enylidene]-3-(2-ethoxyethyl)-1-ethylbenzimidazole-5-carbonitrile.
| Compound Name | 2-[3-[5-cyano-3-(2-ethoxyethyl)-1-ethylbenzimidazol-1-ium-2-yl]prop-2-enylidene]-3-(2-ethoxyethyl)-1-ethylbenzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 3934907 |
| Molecular Formula | C31H37N6O2+ |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 2-[3-[5-cyano-3-(2-ethoxyethyl)-1-ethylbenzimidazol-1-ium-2-yl]prop-2-enylidene]-3-(2-ethoxyethyl)-1-ethylbenzimidazole-5-carbonitrile |
| SMILES | CCOCCN1C(=CC=Cc2n(CCOCC)c3cc(C#N)ccc3[n+]2CC)N(CC)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C31H37N6O2/c1-5-34-26-14-12-24(22-32)20-28(26)36(16-18-38-7-3)30(34)10-9-11-31-35(6-2)27-15-13-25(23-33)21-29(27)37(31)17-19-39-8-4/h9-15,20-21H,5-8,16-19H2,1-4H3/q+1 |
| InChIKey | MIMLWTOOTYCUPG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 81.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|