C37H43N4O4+ — CID 20669565
2-[(E)-3-[1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-2-yl]prop-2-enylidene]-1,3-bis(2-methoxyethyl)benzo[f]benzimidazole (PubChem CID 20669565) has the molecular formula C37H43N4O4+ and a molecular weight of 607.78 g/mol. Its IUPAC name is 2-[(E)-3-[1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-2-yl]prop-2-enylidene]-1,3-bis(2-methoxyethyl)benzo[f]benzimidazole.
| Compound Name | 2-[(E)-3-[1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-2-yl]prop-2-enylidene]-1,3-bis(2-methoxyethyl)benzo[f]benzimidazole |
|---|---|
| PubChem CID | 20669565 |
| Molecular Formula | C37H43N4O4+ |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | 2-[(E)-3-[1,3-bis(2-methoxyethyl)benzo[f]benzimidazol-3-ium-2-yl]prop-2-enylidene]-1,3-bis(2-methoxyethyl)benzo[f]benzimidazole |
| SMILES | COCCN1C(=C/C=C/c2n(CCOC)c3cc4ccccc4cc3[n+]2CCOC)N(CCOC)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C37H43N4O4/c1-42-20-16-38-32-24-28-10-5-6-11-29(28)25-33(32)39(17-21-43-2)36(38)14-9-15-37-40(18-22-44-3)34-26-30-12-7-8-13-31(30)27-35(34)41(37)19-23-45-4/h5-15,24-27H,16-23H2,1-4H3/q+1 |
| InChIKey | LRPJTNLUQZMTTG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|