C29H32N3O+ — CID 15154449
2-[1-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzo[f]benzimidazol-3-ium-3-yl]ethanol (PubChem CID 15154449) has the molecular formula C29H32N3O+ and a molecular weight of 438.60 g/mol. Its IUPAC name is 2-[1-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzo[f]benzimidazol-3-ium-3-yl]ethanol.
| Compound Name | 2-[1-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzo[f]benzimidazol-3-ium-3-yl]ethanol |
|---|---|
| PubChem CID | 15154449 |
| Molecular Formula | C29H32N3O+ |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[1-ethyl-2-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzo[f]benzimidazol-3-ium-3-yl]ethanol |
| SMILES | CCn1c(/C=C/C=C2\N(C)c3ccccc3C2(C)C)[n+](CCO)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C29H32N3O/c1-5-31-25-19-21-11-6-7-12-22(21)20-26(25)32(17-18-33)28(31)16-10-15-27-29(2,3)23-13-8-9-14-24(23)30(27)4/h6-16,19-20,33H,5,17-18H2,1-4H3/q+1 |
| InChIKey | MMVCQYGFJNLHIB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 32.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|