C26H29N2+ — CID 3446881
1-ethyl-6-methyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]quinolin-1-ium (PubChem CID 3446881) has the molecular formula C26H29N2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-ethyl-6-methyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]quinolin-1-ium.
| Compound Name | 1-ethyl-6-methyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]quinolin-1-ium |
|---|---|
| PubChem CID | 3446881 |
| Molecular Formula | C26H29N2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-ethyl-6-methyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]quinolin-1-ium |
| SMILES | CC[n+]1c(C=CC=C2N(C)c3ccccc3C2(C)C)ccc2cc(C)ccc21 |
| InChI | InChI=1S/C26H29N2/c1-6-28-21(16-15-20-18-19(2)14-17-23(20)28)10-9-13-25-26(3,4)22-11-7-8-12-24(22)27(25)5/h7-18H,6H2,1-5H3/q+1 |
| InChIKey | XVTBWDIWHHIYFC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|