C26H29N2S+ — CID 4158080
3-ethyl-5-methyl-4-phenyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-thiazol-3-ium (PubChem CID 4158080) has the molecular formula C26H29N2S+ and a molecular weight of 401.60 g/mol. Its IUPAC name is 3-ethyl-5-methyl-4-phenyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-thiazol-3-ium.
| Compound Name | 3-ethyl-5-methyl-4-phenyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 4158080 |
| Molecular Formula | C26H29N2S+ |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-ethyl-5-methyl-4-phenyl-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-1,3-thiazol-3-ium |
| SMILES | CC[n+]1c(C=CC=C2N(C)c3ccccc3C2(C)C)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C26H29N2S/c1-6-28-24(29-19(2)25(28)20-13-8-7-9-14-20)18-12-17-23-26(3,4)21-15-10-11-16-22(21)27(23)5/h7-18H,6H2,1-5H3/q+1 |
| InChIKey | FXFRCVKSVQRERL-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|