C32H30IN5S — CID 21205404
5-ethyl-20-methyl-6-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-7-thia-2,12,20-triaza-5-azoniapentacyclo[11.7.0.03,11.04,8.014,19]icosa-1,3(11),4(8),5,9,12,14,16,18-nonaene iodide (PubChem CID 21205404) has the molecular formula C32H30IN5S and a molecular weight of 643.60 g/mol. Its IUPAC name is 5-ethyl-20-methyl-6-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-7-thia-2,12,20-triaza-5-azoniapentacyclo[11.7.0.03,11.04,8.014,19]icosa-1,3(11),4(8),5,9,12,14,16,18-nonaene iodide.
| Compound Name | 5-ethyl-20-methyl-6-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-7-thia-2,12,20-triaza-5-azoniapentacyclo[11.7.0.03,11.04,8.014,19]icosa-1,3(11),4(8),5,9,12,14,16,18-nonaene iodide |
|---|---|
| PubChem CID | 21205404 |
| Molecular Formula | C32H30IN5S |
| Molecular Weight | 643.60 g/mol |
| Exact Mass | 643.13 |
| IUPAC Name | 5-ethyl-20-methyl-6-[(E,3Z)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]-7-thia-2,12,20-triaza-5-azoniapentacyclo[11.7.0.03,11.04,8.014,19]icosa-1,3(11),4(8),5,9,12,14,16,18-nonaene iodide |
| SMILES | CC[n+]1c(/C=C/C=C2\N(C)c3ccccc3C2(C)C)sc2ccc3nc4c5ccccc5n(C)c4nc3c21.[I-] |
| InChI | InChI=1S/C32H30N5S.HI/c1-6-37-27(17-11-16-26-32(2,3)21-13-8-10-15-24(21)35(26)4)38-25-19-18-22-29(30(25)37)34-31-28(33-22)20-12-7-9-14-23(20)36(31)5;/h7-19H,6H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | SPFHMZMRNYRKRZ-UHFFFAOYSA-M |
| XLogP | 4.13 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|