C25H25ClF2N3+ — CID 154853334
1-[(E)-2-chloro-1,2-difluoroethenyl]-3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium (PubChem CID 154853334) has the molecular formula C25H25ClF2N3+ and a molecular weight of 440.95 g/mol. Its IUPAC name is 1-[(E)-2-chloro-1,2-difluoroethenyl]-3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium.
| Compound Name | 1-[(E)-2-chloro-1,2-difluoroethenyl]-3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium |
|---|---|
| PubChem CID | 154853334 |
| Molecular Formula | C25H25ClF2N3+ |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1-[(E)-2-chloro-1,2-difluoroethenyl]-3-ethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium |
| SMILES | CC[n+]1c(/C=C/C=C2/N(C)c3ccccc3C2(C)C)n(/C(F)=C(/F)Cl)c2ccccc21 |
| InChI | InChI=1S/C25H25ClF2N3/c1-5-30-19-13-8-9-14-20(19)31(24(28)23(26)27)22(30)16-10-15-21-25(2,3)17-11-6-7-12-18(17)29(21)4/h6-16H,5H2,1-4H3/q+1/b24-23+ |
| InChIKey | OHZMCNSJSMEUNP-WCWDXBQESA-N |
| XLogP | 6.53 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|