C37H34Cl4N3+ — CID 59705962
5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium (PubChem CID 59705962) has the molecular formula C37H34Cl4N3+ and a molecular weight of 662.51 g/mol. Its IUPAC name is 5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium.
| Compound Name | 5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium |
|---|---|
| PubChem CID | 59705962 |
| Molecular Formula | C37H34Cl4N3+ |
| Molecular Weight | 662.51 g/mol |
| Exact Mass | 660.15 |
| IUPAC Name | 5,6-dichloro-1,3-bis[[4-(chloromethyl)phenyl]methyl]-2-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]benzimidazol-3-ium |
| SMILES | CN1C(=CC=Cc2n(Cc3ccc(CCl)cc3)c3cc(Cl)c(Cl)cc3[n+]2Cc2ccc(CCl)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C37H34Cl4N3/c1-37(2)29-7-4-5-8-32(29)42(3)35(37)9-6-10-36-43(23-27-15-11-25(21-38)12-16-27)33-19-30(40)31(41)20-34(33)44(36)24-28-17-13-26(22-39)14-18-28/h4-20H,21-24H2,1-3H3/q+1 |
| InChIKey | PSIYCCHZENVLNY-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.51 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|