C26H25N4S+ — CID 4829586
7-methyl-5-phenyl-3-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]thiadiazolo[3,4-a]pyrimidin-8-ium (PubChem CID 4829586) has the molecular formula C26H25N4S+ and a molecular weight of 425.58 g/mol. Its IUPAC name is 7-methyl-5-phenyl-3-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]thiadiazolo[3,4-a]pyrimidin-8-ium.
| Compound Name | 7-methyl-5-phenyl-3-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]thiadiazolo[3,4-a]pyrimidin-8-ium |
|---|---|
| PubChem CID | 4829586 |
| Molecular Formula | C26H25N4S+ |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 7-methyl-5-phenyl-3-[3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]thiadiazolo[3,4-a]pyrimidin-8-ium |
| SMILES | Cc1cc(-c2ccccc2)nc2c(C=CC=C3N(C)c4ccccc4C3(C)C)sn[n+]12 |
| InChI | InChI=1S/C26H25N4S/c1-18-17-21(19-11-6-5-7-12-19)27-25-23(31-28-30(18)25)15-10-16-24-26(2,3)20-13-8-9-14-22(20)29(24)4/h5-17H,1-4H3/q+1 |
| InChIKey | BSOHCWLKKDKHKE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|