C24H28N3+ — CID 90145610
3,3,7-trimethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]pyrrolo[2,3-b]pyridin-7-ium (PubChem CID 90145610) has the molecular formula C24H28N3+ and a molecular weight of 358.51 g/mol. Its IUPAC name is 3,3,7-trimethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]pyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 3,3,7-trimethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]pyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 90145610 |
| Molecular Formula | C24H28N3+ |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 3,3,7-trimethyl-2-[(E,3E)-3-(1,3,3-trimethylindol-2-ylidene)prop-1-enyl]pyrrolo[2,3-b]pyridin-7-ium |
| SMILES | CN1/C(=C/C=C/C2=Nc3c(ccc[n+]3C)C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H28N3/c1-23(2)18-12-10-16-26(5)22(18)25-20(23)14-9-15-21-24(3,4)17-11-7-8-13-19(17)27(21)6/h7-16H,1-6H3/q+1 |
| InChIKey | FSRKIMIFYBKDGH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 19.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|