C31H37N3O5S — CID 23586376
(2Z)-1-(5-carboxypentyl)-3,3-dimethyl-2-[(2E,4E)-5-(3,3,7-trimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate (PubChem CID 23586376) has the molecular formula C31H37N3O5S and a molecular weight of 563.72 g/mol. Its IUPAC name is (2Z)-1-(5-carboxypentyl)-3,3-dimethyl-2-[(2E,4E)-5-(3,3,7-trimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate.
| Compound Name | (2Z)-1-(5-carboxypentyl)-3,3-dimethyl-2-[(2E,4E)-5-(3,3,7-trimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate |
|---|---|
| PubChem CID | 23586376 |
| Molecular Formula | C31H37N3O5S |
| Molecular Weight | 563.72 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | (2Z)-1-(5-carboxypentyl)-3,3-dimethyl-2-[(2E,4E)-5-(3,3,7-trimethylpyrrolo[2,3-b]pyridin-7-ium-2-yl)penta-2,4-dienylidene]indole-5-sulfonate |
| SMILES | C[n+]1cccc2c1N=C(/C=C/C=C/C=C1\N(CCCCCC(=O)O)c3ccc(S(=O)(=O)[O-])cc3C1(C)C)C2(C)C |
| InChI | InChI=1S/C31H37N3O5S/c1-30(2)23-13-12-19-33(5)29(23)32-26(30)14-8-6-9-15-27-31(3,4)24-21-22(40(37,38)39)17-18-25(24)34(27)20-11-7-10-16-28(35)36/h6,8-9,12-15,17-19,21H,7,10-11,16,20H2,1-5H3,(H-,35,36,37,38,39) |
| InChIKey | RCYCKYKWUCAGHC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.72 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|