C29H34N2O2 — CID 134426243
6-[(2E)-2-[(E)-3-(3,3-dimethylindol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid (PubChem CID 134426243) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 6-[(2E)-2-[(E)-3-(3,3-dimethylindol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(E)-3-(3,3-dimethylindol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 134426243 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 6-[(2E)-2-[(E)-3-(3,3-dimethylindol-2-yl)prop-2-enylidene]-3,3-dimethylindol-1-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C2/N(CCCCCC(=O)O)c3ccccc3C2(C)C)=Nc2ccccc21 |
| InChI | InChI=1S/C29H34N2O2/c1-28(2)21-13-7-9-15-23(21)30-25(28)17-12-18-26-29(3,4)22-14-8-10-16-24(22)31(26)20-11-5-6-19-27(32)33/h7-10,12-18H,5-6,11,19-20H2,1-4H3,(H,32,33)/b17-12+,26-18+ |
| InChIKey | ANNYYQJTBOJQSK-OPKUYFDJSA-N |
| XLogP | 6.93 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|