C38H43N2O3+ — CID 91394108
[4-[3-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-2-phenylchromen-7-ylidene]-diethylazanium (PubChem CID 91394108) has the molecular formula C38H43N2O3+ and a molecular weight of 575.77 g/mol. Its IUPAC name is [4-[3-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-2-phenylchromen-7-ylidene]-diethylazanium.
| Compound Name | [4-[3-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-2-phenylchromen-7-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 91394108 |
| Molecular Formula | C38H43N2O3+ |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | [4-[3-[1-(5-carboxypentyl)-3,3-dimethylindol-2-ylidene]prop-1-enyl]-2-phenylchromen-7-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=c1ccc2c(C=CC=C3N(CCCCCC(=O)O)c4ccccc4C3(C)C)cc(-c3ccccc3)oc-2c1 |
| InChI | InChI=1S/C38H42N2O3/c1-5-39(6-2)30-23-24-31-29(26-34(43-35(31)27-30)28-16-9-7-10-17-28)18-15-21-36-38(3,4)32-19-12-13-20-33(32)40(36)25-14-8-11-22-37(41)42/h7,9-10,12-13,15-21,23-24,26-27H,5-6,8,11,14,22,25H2,1-4H3/p+1 |
| InChIKey | DDMVCSFUINKDOR-UHFFFAOYSA-O |
| XLogP | 8.20 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|