C45H53N2O8S+ — CID 123847046
[2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-4-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium (PubChem CID 123847046) has the molecular formula C45H53N2O8S+ and a molecular weight of 781.99 g/mol. Its IUPAC name is [2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-4-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium.
| Compound Name | [2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-4-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 123847046 |
| Molecular Formula | C45H53N2O8S+ |
| Molecular Weight | 781.99 g/mol |
| Exact Mass | 781.35 |
| IUPAC Name | [2-[7-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]hepta-1,3,5-trienyl]-3-methyl-4-phenylchromen-7-ylidene]-bis(2-methoxyethyl)azanium |
| SMILES | COCC[N+](CCOC)=c1ccc2c(-c3ccccc3)c(C)c(C=CC=CC=CC=C3N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)oc-2c1 |
| InChI | InChI=1S/C45H52N2O8S/c1-33-40(55-41-31-35(46(27-29-53-4)28-30-54-5)22-24-37(41)44(33)34-17-11-9-12-18-34)19-13-7-6-8-14-20-42-45(2,3)38-32-36(56(50,51)52)23-25-39(38)47(42)26-16-10-15-21-43(48)49/h6-9,11-14,17-20,22-25,31-32H,10,15-16,21,26-30H2,1-5H3,(H-,48,49,50,51,52)/p+1 |
| InChIKey | RDFSHXCTAGXOMZ-UHFFFAOYSA-O |
| XLogP | 8.12 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.99 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|