C40H52N2O8S — CID 140697027
(2E)-2-[(2E,4E)-5-[7-[bis(2-methoxyethyl)azaniumylidene]-2-tert-butylchromen-4-yl]penta-2,4-dienylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate (PubChem CID 140697027) has the molecular formula C40H52N2O8S and a molecular weight of 720.93 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-[7-[bis(2-methoxyethyl)azaniumylidene]-2-tert-butylchromen-4-yl]penta-2,4-dienylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate.
| Compound Name | (2E)-2-[(2E,4E)-5-[7-[bis(2-methoxyethyl)azaniumylidene]-2-tert-butylchromen-4-yl]penta-2,4-dienylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate |
|---|---|
| PubChem CID | 140697027 |
| Molecular Formula | C40H52N2O8S |
| Molecular Weight | 720.93 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-[7-[bis(2-methoxyethyl)azaniumylidene]-2-tert-butylchromen-4-yl]penta-2,4-dienylidene]-1-(5-carboxypentyl)-3,3-dimethylindole-5-sulfonate |
| SMILES | COCC[N+](CCOC)=c1ccc2c(/C=C/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)[O-])cc4C3(C)C)cc(C(C)(C)C)oc-2c1 |
| InChI | InChI=1S/C40H52N2O8S/c1-39(2,3)37-26-29(32-19-17-30(27-35(32)50-37)41(22-24-48-6)23-25-49-7)14-10-8-11-15-36-40(4,5)33-28-31(51(45,46)47)18-20-34(33)42(36)21-13-9-12-16-38(43)44/h8,10-11,14-15,17-20,26-28H,9,12-13,16,21-25H2,1-7H3,(H-,43,44,45,46,47) |
| InChIKey | ODUJEQFXFBOOQJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.93 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|