C38H51N2O8S+ — CID 140696777
[4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium (PubChem CID 140696777) has the molecular formula C38H51N2O8S+ and a molecular weight of 695.90 g/mol. Its IUPAC name is [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium.
| Compound Name | [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 140696777 |
| Molecular Formula | C38H51N2O8S+ |
| Molecular Weight | 695.90 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3,3-dimethyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-bis(2-methoxyethyl)azanium |
| SMILES | COCC[N+](CCOC)=c1ccc2c(C(C)(C)C)cc(/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)oc-2c1 |
| InChI | InChI=1S/C38H50N2O8S/c1-37(2,3)31-25-28(48-34-24-27(15-17-30(31)34)39(20-22-46-6)21-23-47-7)12-11-13-35-38(4,5)32-26-29(49(43,44)45)16-18-33(32)40(35)19-10-8-9-14-36(41)42/h11-13,15-18,24-26H,8-10,14,19-23H2,1-7H3,(H-,41,42,43,44,45)/p+1 |
| InChIKey | RTPAURFWBNWULR-UHFFFAOYSA-O |
| XLogP | 6.33 |
| TPSA | 129.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.90 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|