C38H51N2O7S+ — CID 140697123
[4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-diethylazanium (PubChem CID 140697123) has the molecular formula C38H51N2O7S+ and a molecular weight of 679.90 g/mol. Its IUPAC name is [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-diethylazanium.
| Compound Name | [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 140697123 |
| Molecular Formula | C38H51N2O7S+ |
| Molecular Weight | 679.90 g/mol |
| Exact Mass | 679.34 |
| IUPAC Name | [4-tert-butyl-2-[(E,3E)-3-[1-(5-carboxypentyl)-3-(2-methoxyethyl)-3-methyl-5-sulfoindol-2-ylidene]prop-1-enyl]chromen-7-ylidene]-diethylazanium |
| SMILES | CC[N+](CC)=c1ccc2c(C(C)(C)C)cc(/C=C/C=C3/N(CCCCCC(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)CCOC)oc-2c1 |
| InChI | InChI=1S/C38H50N2O7S/c1-8-39(9-2)27-17-19-30-31(37(3,4)5)25-28(47-34(30)24-27)14-13-15-35-38(6,21-23-46-7)32-26-29(48(43,44)45)18-20-33(32)40(35)22-12-10-11-16-36(41)42/h13-15,17-20,24-26H,8-12,16,21-23H2,1-7H3,(H-,41,42,43,44,45)/p+1 |
| InChIKey | WVQLNFAZLUEEJO-UHFFFAOYSA-O |
| XLogP | 7.10 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.90 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|