C63H61BN2 — CID 10010821
bis(4-methylphenyl)-bis(4-phenylphenyl)boranuide;(2E)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 10010821) has the molecular formula C63H61BN2 and a molecular weight of 857.01 g/mol. Its IUPAC name is bis(4-methylphenyl)-bis(4-phenylphenyl)boranuide;(2E)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | bis(4-methylphenyl)-bis(4-phenylphenyl)boranuide;(2E)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 10010821 |
| Molecular Formula | C63H61BN2 |
| Molecular Weight | 857.01 g/mol |
| Exact Mass | 856.49 |
| IUPAC Name | bis(4-methylphenyl)-bis(4-phenylphenyl)boranuide;(2E)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | CN1/C(=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.Cc1ccc([B-](c2ccc(C)cc2)(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C38H32B.C25H29N2/c1-29-13-21-35(22-14-29)39(36-23-15-30(2)16-24-36,37-25-17-33(18-26-37)31-9-5-3-6-10-31)38-27-19-34(20-28-38)32-11-7-4-8-12-32;1-24(2)18-12-7-9-14-20(18)26(5)22(24)16-11-17-23-25(3,4)19-13-8-10-15-21(19)27(23)6/h3-28H,1-2H3;7-17H,1-6H3/q-1;+1 |
| InChIKey | DLOKFKHEPBYWLH-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.01 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|