C36H43BF4N2 — CID 73011046
2-[(E)-3-[5,5-dimethyl-3-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]cyclohexen-1-yl]prop-2-enylidene]-1,3,3-trimethylindole tetrafluoroborate (PubChem CID 73011046) has the molecular formula C36H43BF4N2 and a molecular weight of 590.56 g/mol. Its IUPAC name is 2-[(E)-3-[5,5-dimethyl-3-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]cyclohexen-1-yl]prop-2-enylidene]-1,3,3-trimethylindole tetrafluoroborate.
| Compound Name | 2-[(E)-3-[5,5-dimethyl-3-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]cyclohexen-1-yl]prop-2-enylidene]-1,3,3-trimethylindole tetrafluoroborate |
|---|---|
| PubChem CID | 73011046 |
| Molecular Formula | C36H43BF4N2 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | 2-[(E)-3-[5,5-dimethyl-3-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]cyclohexen-1-yl]prop-2-enylidene]-1,3,3-trimethylindole tetrafluoroborate |
| SMILES | CN1C(=C/C=C/C2=CC(=C/C=C/C3=[N+](C)c4ccccc4C3(C)C)CC(C)(C)C2)C(C)(C)c2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C36H43N2.BF4/c1-34(2)24-26(15-13-21-32-35(3,4)28-17-9-11-19-30(28)37(32)7)23-27(25-34)16-14-22-33-36(5,6)29-18-10-12-20-31(29)38(33)8;2-1(3,4)5/h9-23H,24-25H2,1-8H3;/q+1;-1 |
| InChIKey | CQVFZRVKJDHJFY-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|