C30H35N2+ — CID 58741766
(2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-5-methyl-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole (PubChem CID 58741766) has the molecular formula C30H35N2+ and a molecular weight of 423.62 g/mol. Its IUPAC name is (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-5-methyl-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole.
| Compound Name | (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-5-methyl-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole |
|---|---|
| PubChem CID | 58741766 |
| Molecular Formula | C30H35N2+ |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | (2E)-1,3,3-trimethyl-2-[(2E,4E,6E)-5-methyl-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]indole |
| SMILES | CC(/C=C/C1=[N+](C)c2ccccc2C1(C)C)=C\C=C\C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C30H35N2/c1-22(20-21-28-30(4,5)24-16-10-12-18-26(24)32(28)7)14-8-13-19-27-29(2,3)23-15-9-11-17-25(23)31(27)6/h8-21H,1-7H3/q+1 |
| InChIKey | LCKYLSZOPQCXPW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|