C35H44N3O2+ — CID 72538738
tert-butyl N-methyl-N-[1-(1,3,3-trimethylindol-1-ium-2-yl)-7-(1,3,3-trimethylindol-2-ylidene)hepta-1,3,5-trien-4-yl]carbamate (PubChem CID 72538738) has the molecular formula C35H44N3O2+ and a molecular weight of 538.76 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-(1,3,3-trimethylindol-1-ium-2-yl)-7-(1,3,3-trimethylindol-2-ylidene)hepta-1,3,5-trien-4-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-(1,3,3-trimethylindol-1-ium-2-yl)-7-(1,3,3-trimethylindol-2-ylidene)hepta-1,3,5-trien-4-yl]carbamate |
|---|---|
| PubChem CID | 72538738 |
| Molecular Formula | C35H44N3O2+ |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | tert-butyl N-methyl-N-[1-(1,3,3-trimethylindol-1-ium-2-yl)-7-(1,3,3-trimethylindol-2-ylidene)hepta-1,3,5-trien-4-yl]carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(C=CC=C1N(C)c2ccccc2C1(C)C)=CC=CC1=[N+](C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C35H44N3O2/c1-33(2,3)40-32(39)36(8)25(17-15-23-30-34(4,5)26-19-11-13-21-28(26)37(30)9)18-16-24-31-35(6,7)27-20-12-14-22-29(27)38(31)10/h11-24H,1-10H3/q+1 |
| InChIKey | GWTMYSKIUOETHE-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 35.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|