C40H54N3O2+ — CID 171840851
ethane;methyl 6-[(2E)-2-[(2E,4Z,6E)-4-cyano-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]hexanoate (PubChem CID 171840851) has the molecular formula C40H54N3O2+ and a molecular weight of 608.89 g/mol. Its IUPAC name is ethane;methyl 6-[(2E)-2-[(2E,4Z,6E)-4-cyano-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]hexanoate.
| Compound Name | ethane;methyl 6-[(2E)-2-[(2E,4Z,6E)-4-cyano-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]hexanoate |
|---|---|
| PubChem CID | 171840851 |
| Molecular Formula | C40H54N3O2+ |
| Molecular Weight | 608.89 g/mol |
| Exact Mass | 608.42 |
| IUPAC Name | ethane;methyl 6-[(2E)-2-[(2E,4Z,6E)-4-cyano-7-(1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]hexanoate |
| SMILES | CC.CC.COC(=O)CCCCCN1/C(=C/C=C/C(C#N)=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C36H42N3O2.2C2H6/c1-35(2)28-18-9-11-20-30(28)38(5)32(35)22-14-16-27(26-37)17-15-23-33-36(3,4)29-19-10-12-21-31(29)39(33)25-13-7-8-24-34(40)41-6;2*1-2/h9-12,14-23H,7-8,13,24-25H2,1-6H3;2*1-2H3/q+1;; |
| InChIKey | XLSNXOXMHMUPBW-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 56.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.89 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|