C28H33N2O+ — CID 171393638
2-[(2E)-1,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-3-yl]ethanol (PubChem CID 171393638) has the molecular formula C28H33N2O+ and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-[(2E)-1,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-3-yl]ethanol.
| Compound Name | 2-[(2E)-1,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-3-yl]ethanol |
|---|---|
| PubChem CID | 171393638 |
| Molecular Formula | C28H33N2O+ |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 2-[(2E)-1,3-dimethyl-2-[(2E,4E)-5-(1,3,3-trimethylindol-1-ium-2-yl)penta-2,4-dienylidene]indol-3-yl]ethanol |
| SMILES | CN1/C(=C/C=C/C=C/C2=[N+](C)c3ccccc3C2(C)C)C(C)(CCO)c2ccccc21 |
| InChI | InChI=1S/C28H33N2O/c1-27(2)21-13-9-11-15-23(21)29(4)25(27)17-7-6-8-18-26-28(3,19-20-31)22-14-10-12-16-24(22)30(26)5/h6-18,31H,19-20H2,1-5H3/q+1 |
| InChIKey | MRQKRGSNPBHRQT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|