C31H33N2+ — CID 23550944
1,3,3-trimethyl-2-[(1E,3E,5Z)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]benzo[g]indol-1-ium (PubChem CID 23550944) has the molecular formula C31H33N2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5Z)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]benzo[g]indol-1-ium.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5Z)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]benzo[g]indol-1-ium |
|---|---|
| PubChem CID | 23550944 |
| Molecular Formula | C31H33N2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5Z)-5-(1,3,3-trimethylindol-2-ylidene)penta-1,3-dienyl]benzo[g]indol-1-ium |
| SMILES | CN1/C(=C\C=C\C=C\C2=[N+](C)c3c(ccc4ccccc34)C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C31H33N2/c1-30(2)24-16-12-13-17-26(24)32(5)27(30)18-8-7-9-19-28-31(3,4)25-21-20-22-14-10-11-15-23(22)29(25)33(28)6/h7-21H,1-6H3/q+1 |
| InChIKey | WBVDJPVLOUTENW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|