C37H37N2+ — CID 2735054
1,3,3-trimethyl-2-[7-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[g]indole (PubChem CID 2735054) has the molecular formula C37H37N2+ and a molecular weight of 509.72 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[7-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[g]indole.
| Compound Name | 1,3,3-trimethyl-2-[7-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[g]indole |
|---|---|
| PubChem CID | 2735054 |
| Molecular Formula | C37H37N2+ |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 1,3,3-trimethyl-2-[7-(1,3,3-trimethylbenzo[g]indol-1-ium-2-yl)hepta-2,4,6-trienylidene]benzo[g]indole |
| SMILES | CN1C(=CC=CC=CC=CC2=[N+](C)c3c(ccc4ccccc34)C2(C)C)C(C)(C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C37H37N2/c1-36(2)30-24-22-26-16-12-14-18-28(26)34(30)38(5)32(36)20-10-8-7-9-11-21-33-37(3,4)31-25-23-27-17-13-15-19-29(27)35(31)39(33)6/h7-25H,1-6H3/q+1 |
| InChIKey | CWVCWXWMSZAMMV-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|