C29H28N5+ — CID 59041188
1,3-dimethyl-2-[3-(1,3,3-trimethylbenzo[g]indol-2-ylidene)prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium (PubChem CID 59041188) has the molecular formula C29H28N5+ and a molecular weight of 446.58 g/mol. Its IUPAC name is 1,3-dimethyl-2-[3-(1,3,3-trimethylbenzo[g]indol-2-ylidene)prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium.
| Compound Name | 1,3-dimethyl-2-[3-(1,3,3-trimethylbenzo[g]indol-2-ylidene)prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium |
|---|---|
| PubChem CID | 59041188 |
| Molecular Formula | C29H28N5+ |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 1,3-dimethyl-2-[3-(1,3,3-trimethylbenzo[g]indol-2-ylidene)prop-1-enyl]imidazo[4,5-b]quinoxalin-3-ium |
| SMILES | CN1C(=CC=Cc2n(C)c3nc4ccccc4nc3[n+]2C)C(C)(C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C29H28N5/c1-29(2)21-18-17-19-11-6-7-12-20(19)26(21)32(3)24(29)15-10-16-25-33(4)27-28(34(25)5)31-23-14-9-8-13-22(23)30-27/h6-18H,1-5H3/q+1 |
| InChIKey | SOYZTDGPJYARAZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|