C34H37ClN5+ — CID 59041190
2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-6-chloro-1,3-diethylimidazo[4,5-b]quinoxalin-1-ium (PubChem CID 59041190) has the molecular formula C34H37ClN5+ and a molecular weight of 551.16 g/mol. Its IUPAC name is 2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-6-chloro-1,3-diethylimidazo[4,5-b]quinoxalin-1-ium.
| Compound Name | 2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-6-chloro-1,3-diethylimidazo[4,5-b]quinoxalin-1-ium |
|---|---|
| PubChem CID | 59041190 |
| Molecular Formula | C34H37ClN5+ |
| Molecular Weight | 551.16 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | 2-[3-(3-butyl-1,1-dimethylbenzo[e]indol-2-ylidene)prop-1-enyl]-6-chloro-1,3-diethylimidazo[4,5-b]quinoxalin-1-ium |
| SMILES | CCCCN1C(=CC=Cc2n(CC)c3nc4cc(Cl)ccc4nc3[n+]2CC)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C34H37ClN5/c1-6-9-21-40-28-20-17-23-13-10-11-14-25(23)31(28)34(4,5)29(40)15-12-16-30-38(7-2)32-33(39(30)8-3)37-27-22-24(35)18-19-26(27)36-32/h10-20,22H,6-9,21H2,1-5H3/q+1 |
| InChIKey | OILMGNMSIKJPPG-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.16 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|