C47H43N2+ — CID 76639602
1-benzyl-2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1,3-dimethylbenzo[e]indole (PubChem CID 76639602) has the molecular formula C47H43N2+ and a molecular weight of 635.88 g/mol. Its IUPAC name is 1-benzyl-2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1,3-dimethylbenzo[e]indole.
| Compound Name | 1-benzyl-2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1,3-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 76639602 |
| Molecular Formula | C47H43N2+ |
| Molecular Weight | 635.88 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | 1-benzyl-2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1,3-dimethylbenzo[e]indole |
| SMILES | CN1C(=CC=CC=CC2=[N+](C)c3c(ccc4ccccc34)C2(C)Cc2ccccc2)C(C)(Cc2ccccc2)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C47H43N2/c1-46(32-34-18-8-5-9-19-34)40-30-28-37-23-15-17-25-39(37)45(40)49(4)42(46)26-12-7-13-27-43-47(2,33-35-20-10-6-11-21-35)44-38-24-16-14-22-36(38)29-31-41(44)48(43)3/h5-31H,32-33H2,1-4H3/q+1 |
| InChIKey | RDBWURUJHQQHCR-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.88 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|