C43H40BrN2+ — CID 76593896
2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1-(3-bromoprop-2-enyl)-1,3-dimethylbenzo[e]indole (PubChem CID 76593896) has the molecular formula C43H40BrN2+ and a molecular weight of 664.71 g/mol. Its IUPAC name is 2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1-(3-bromoprop-2-enyl)-1,3-dimethylbenzo[e]indole.
| Compound Name | 2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1-(3-bromoprop-2-enyl)-1,3-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 76593896 |
| Molecular Formula | C43H40BrN2+ |
| Molecular Weight | 664.71 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | 2-[5-(3-benzyl-1,3-dimethylbenzo[g]indol-1-ium-2-yl)penta-2,4-dienylidene]-1-(3-bromoprop-2-enyl)-1,3-dimethylbenzo[e]indole |
| SMILES | CN1C(=CC=CC=CC2=[N+](C)c3c(ccc4ccccc34)C2(C)Cc2ccccc2)C(C)(CC=CBr)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C43H40BrN2/c1-42(28-15-29-44)38(45(3)37-27-25-32-18-11-13-20-34(32)40(37)42)22-9-6-10-23-39-43(2,30-31-16-7-5-8-17-31)36-26-24-33-19-12-14-21-35(33)41(36)46(39)4/h5-27,29H,28,30H2,1-4H3/q+1 |
| InChIKey | ANFWTCRXTMIKED-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.71 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|