C47H45N2+ — CID 76785085
1-benzyl-2-[9-(3-benzyl-1,3-dimethylindol-2-ylidene)nona-1,3,5,7-tetraenyl]-1,3-dimethylbenzo[e]indol-3-ium (PubChem CID 76785085) has the molecular formula C47H45N2+ and a molecular weight of 637.89 g/mol. Its IUPAC name is 1-benzyl-2-[9-(3-benzyl-1,3-dimethylindol-2-ylidene)nona-1,3,5,7-tetraenyl]-1,3-dimethylbenzo[e]indol-3-ium.
| Compound Name | 1-benzyl-2-[9-(3-benzyl-1,3-dimethylindol-2-ylidene)nona-1,3,5,7-tetraenyl]-1,3-dimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 76785085 |
| Molecular Formula | C47H45N2+ |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.36 |
| IUPAC Name | 1-benzyl-2-[9-(3-benzyl-1,3-dimethylindol-2-ylidene)nona-1,3,5,7-tetraenyl]-1,3-dimethylbenzo[e]indol-3-ium |
| SMILES | CN1C(=CC=CC=CC=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(C)Cc2ccccc2)C(C)(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C47H45N2/c1-46(34-36-22-12-10-13-23-36)40-28-20-21-29-41(40)48(3)43(46)30-16-8-6-5-7-9-17-31-44-47(2,35-37-24-14-11-15-25-37)45-39-27-19-18-26-38(39)32-33-42(45)49(44)4/h5-33H,34-35H2,1-4H3/q+1 |
| InChIKey | XCNMUYRJYFDYKD-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|