C27H29F6N4+ — CID 72740551
2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole (PubChem CID 72740551) has the molecular formula C27H29F6N4+ and a molecular weight of 523.55 g/mol. Its IUPAC name is 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole.
| Compound Name | 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 72740551 |
| Molecular Formula | C27H29F6N4+ |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-[3-[1,3-diethyl-5-(trifluoromethyl)benzimidazol-1-ium-2-yl]prop-2-enylidene]-1,3-diethyl-5-(trifluoromethyl)benzimidazole |
| SMILES | CCN1C(=CC=Cc2n(CC)c3cc(C(F)(F)F)ccc3[n+]2CC)N(CC)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C27H29F6N4/c1-5-34-20-14-12-18(26(28,29)30)16-22(20)36(7-3)24(34)10-9-11-25-35(6-2)21-15-13-19(27(31,32)33)17-23(21)37(25)8-4/h9-17H,5-8H2,1-4H3/q+1 |
| InChIKey | YDTSDZYAUXWEEV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|