C31H37Cl2N4O4+ — CID 45105871
diethyl 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1,3-diethylbenzimidazol-3-ium-5,6-dicarboxylate (PubChem CID 45105871) has the molecular formula C31H37Cl2N4O4+ and a molecular weight of 600.57 g/mol. Its IUPAC name is diethyl 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1,3-diethylbenzimidazol-3-ium-5,6-dicarboxylate.
| Compound Name | diethyl 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1,3-diethylbenzimidazol-3-ium-5,6-dicarboxylate |
|---|---|
| PubChem CID | 45105871 |
| Molecular Formula | C31H37Cl2N4O4+ |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | diethyl 2-[(E)-3-(5,6-dichloro-1,3-diethylbenzimidazol-2-ylidene)prop-1-enyl]-1,3-diethylbenzimidazol-3-ium-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc2c(cc1C(=O)OCC)[n+](CC)c(/C=C/C=C1N(CC)c3cc(Cl)c(Cl)cc3N1CC)n2CC |
| InChI | InChI=1S/C31H37Cl2N4O4/c1-7-34-24-16-20(30(38)40-11-5)21(31(39)41-12-6)17-25(24)35(8-2)28(34)14-13-15-29-36(9-3)26-18-22(32)23(33)19-27(26)37(29)10-4/h13-19H,7-12H2,1-6H3/q+1 |
| InChIKey | XUNQXXOBKCAAJC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|