C26H28N5+ — CID 87445812
1,3-diethyl-2-[2-(4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-3-ylidene)ethylidene]benzimidazole-5-carbonitrile (PubChem CID 87445812) has the molecular formula C26H28N5+ and a molecular weight of 410.55 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-3-ylidene)ethylidene]benzimidazole-5-carbonitrile.
| Compound Name | 1,3-diethyl-2-[2-(4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-3-ylidene)ethylidene]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 87445812 |
| Molecular Formula | C26H28N5+ |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1,3-diethyl-2-[2-(4-ethyl-1,2-dihydropyrrolo[1,2-a]benzimidazol-9-ium-3-ylidene)ethylidene]benzimidazole-5-carbonitrile |
| SMILES | CCN1C(=CC=C2CC[n+]3c2n(CC)c2ccccc23)N(CC)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C26H28N5/c1-4-28-23-13-11-19(18-27)17-24(23)29(5-2)25(28)14-12-20-15-16-31-22-10-8-7-9-21(22)30(6-3)26(20)31/h7-14,17H,4-6,15-16H2,1-3H3/q+1 |
| InChIKey | NAJCHBAQYURWNN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 39.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|