C16H11N3S — CID 102137562
10-ethylphenothiazine-3,7-dicarbonitrile (PubChem CID 102137562) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 10-ethylphenothiazine-3,7-dicarbonitrile.
| Compound Name | 10-ethylphenothiazine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 102137562 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 10-ethylphenothiazine-3,7-dicarbonitrile |
| SMILES | CCN1c2ccc(C#N)cc2Sc2cc(C#N)ccc21 |
| InChI | InChI=1S/C16H11N3S/c1-2-19-13-5-3-11(9-17)7-15(13)20-16-8-12(10-18)4-6-14(16)19/h3-8H,2H2,1H3 |
| InChIKey | XHBNXBOAFVPLAO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |