C40H30N4S2 — CID 69121329
2,5-bis[2-(10-ethylphenothiazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 69121329) has the molecular formula C40H30N4S2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 2,5-bis[2-(10-ethylphenothiazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis[2-(10-ethylphenothiazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 69121329 |
| Molecular Formula | C40H30N4S2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | 2,5-bis[2-(10-ethylphenothiazin-3-yl)ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | CCN1c2ccccc2Sc2cc(C=Cc3cc(C#N)c(C=Cc4ccc5c(c4)Sc4ccccc4N5CC)cc3C#N)ccc21 |
| InChI | InChI=1S/C40H30N4S2/c1-3-43-33-9-5-7-11-37(33)45-39-21-27(15-19-35(39)43)13-17-29-23-32(26-42)30(24-31(29)25-41)18-14-28-16-20-36-40(22-28)46-38-12-8-6-10-34(38)44(36)4-2/h5-24H,3-4H2,1-2H3 |
| InChIKey | HBCVJUNARQCZFF-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|