C64H54F6N2S2 — CID 23624928
10-hexyl-3-[(E)-2-[4-[(E)-2-(10-hexylphenothiazin-3-yl)ethenyl]-2,5-bis[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]ethenyl]phenothiazine (PubChem CID 23624928) has the molecular formula C64H54F6N2S2 and a molecular weight of 1029.27 g/mol. Its IUPAC name is 10-hexyl-3-[(E)-2-[4-[(E)-2-(10-hexylphenothiazin-3-yl)ethenyl]-2,5-bis[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]ethenyl]phenothiazine.
| Compound Name | 10-hexyl-3-[(E)-2-[4-[(E)-2-(10-hexylphenothiazin-3-yl)ethenyl]-2,5-bis[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]ethenyl]phenothiazine |
|---|---|
| PubChem CID | 23624928 |
| Molecular Formula | C64H54F6N2S2 |
| Molecular Weight | 1029.27 g/mol |
| Exact Mass | 1028.36 |
| IUPAC Name | 10-hexyl-3-[(E)-2-[4-[(E)-2-(10-hexylphenothiazin-3-yl)ethenyl]-2,5-bis[2-[3-(trifluoromethyl)phenyl]ethynyl]phenyl]ethenyl]phenothiazine |
| SMILES | CCCCCCN1c2ccccc2Sc2cc(/C=C/c3cc(C#Cc4cccc(C(F)(F)F)c4)c(/C=C/c4ccc5c(c4)Sc4ccccc4N5CCCCCC)cc3C#Cc3cccc(C(F)(F)F)c3)ccc21 |
| InChI | InChI=1S/C64H54F6N2S2/c1-3-5-7-13-37-71-55-21-9-11-23-59(55)73-61-41-47(29-35-57(61)71)27-33-51-43-50(32-26-46-18-16-20-54(40-46)64(68,69)70)52(44-49(51)31-25-45-17-15-19-53(39-45)63(65,66)67)34-28-48-30-36-58-62(42-48)74-60-24-12-10-22-56(60)72(58)38-14-8-6-4-2/h9-12,15-24,27-30,33-36,39-44H,3-8,13-14,37-38H2,1-2H3/b33-27+,34-28+ |
| InChIKey | GOSJHDMZLMDTQR-SWMYPXFDSA-N |
| XLogP | 19.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.27 |
| LogP ≤ 5 | 19.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|