C12H14ClN3 — CID 67082036
2-chloro-1,3-diethyl-2H-benzimidazole-5-carbonitrile (PubChem CID 67082036) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 2-chloro-1,3-diethyl-2H-benzimidazole-5-carbonitrile.
| Compound Name | 2-chloro-1,3-diethyl-2H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 67082036 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 2-chloro-1,3-diethyl-2H-benzimidazole-5-carbonitrile |
| SMILES | CCN1c2ccc(C#N)cc2N(CC)C1Cl |
| InChI | InChI=1S/C12H14ClN3/c1-3-15-10-6-5-9(8-14)7-11(10)16(4-2)12(15)13/h5-7,12H,3-4H2,1-2H3 |
| InChIKey | ASLTZSZPCJAIAH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|