C13H11ClN2 — CID 107808307
3-chloro-4-(2,5-dimethylpyrrol-1-yl)benzonitrile (PubChem CID 107808307) has the molecular formula C13H11ClN2 and a molecular weight of 230.70 g/mol. Its IUPAC name is 3-chloro-4-(2,5-dimethylpyrrol-1-yl)benzonitrile.
| Compound Name | 3-chloro-4-(2,5-dimethylpyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107808307 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-chloro-4-(2,5-dimethylpyrrol-1-yl)benzonitrile |
| SMILES | Cc1ccc(C)n1-c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C13H11ClN2/c1-9-3-4-10(2)16(9)13-6-5-11(8-15)7-12(13)14/h3-7H,1-2H3 |
| InChIKey | ZNSGYVSTJZQURD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|