C14H11ClN2O — CID 107808795
3-chloro-4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile (PubChem CID 107808795) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 3-chloro-4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile.
| Compound Name | 3-chloro-4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107808795 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-chloro-4-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile |
| SMILES | Cc1cc(C=O)c(C)n1-c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C14H11ClN2O/c1-9-5-12(8-18)10(2)17(9)14-4-3-11(7-16)6-13(14)15/h3-6,8H,1-2H3 |
| InChIKey | NICRJINMGKVURC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|