C14H11FN2O — CID 43580719
2-fluoro-6-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile (PubChem CID 43580719) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-fluoro-6-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile.
| Compound Name | 2-fluoro-6-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 43580719 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-fluoro-6-(3-formyl-2,5-dimethylpyrrol-1-yl)benzonitrile |
| SMILES | Cc1cc(C=O)c(C)n1-c1cccc(F)c1C#N |
| InChI | InChI=1S/C14H11FN2O/c1-9-6-11(8-18)10(2)17(9)14-5-3-4-13(15)12(14)7-16/h3-6,8H,1-2H3 |
| InChIKey | AZEXUZVEMONEFN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|