C28H23F2N3O — CID 6077165
(E)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 6077165) has the molecular formula C28H23F2N3O and a molecular weight of 455.51 g/mol. Its IUPAC name is (E)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6077165 |
| Molecular Formula | C28H23F2N3O |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (E)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)c2cc(C)n(-c3ccccc3F)c2C)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C28H23F2N3O/c1-17-13-21(19(3)32(17)26-11-7-5-9-24(26)29)15-22(16-31)28(34)23-14-18(2)33(20(23)4)27-12-8-6-10-25(27)30/h5-15H,1-4H3/b22-15+ |
| InChIKey | AQAQFKYKLLHQKI-PXLXIMEGSA-N |
| XLogP | 6.57 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|