C22H15Cl2FN2O — CID 5201829
3-(3,4-dichlorophenyl)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile (PubChem CID 5201829) has the molecular formula C22H15Cl2FN2O and a molecular weight of 413.28 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile.
| Compound Name | 3-(3,4-dichlorophenyl)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5201829 |
| Molecular Formula | C22H15Cl2FN2O |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-[1-(2-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
| SMILES | Cc1cc(C(=O)C(C#N)=Cc2ccc(Cl)c(Cl)c2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C22H15Cl2FN2O/c1-13-9-17(14(2)27(13)21-6-4-3-5-20(21)25)22(28)16(12-26)10-15-7-8-18(23)19(24)11-15/h3-11H,1-2H3 |
| InChIKey | LLAFBZWPNZLBJZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|