C24H18F2N2O4 — CID 6216238
(E)-3-(1,3-benzodioxol-5-yl)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile (PubChem CID 6216238) has the molecular formula C24H18F2N2O4 and a molecular weight of 436.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6216238 |
| Molecular Formula | C24H18F2N2O4 |
| Molecular Weight | 436.41 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]prop-2-enenitrile |
| SMILES | Cc1cc(C(=O)/C(C#N)=C/c2ccc3c(c2)OCO3)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H18F2N2O4/c1-14-9-20(15(2)28(14)18-4-6-19(7-5-18)32-24(25)26)23(29)17(12-27)10-16-3-8-21-22(11-16)31-13-30-21/h3-11,24H,13H2,1-2H3/b17-10+ |
| InChIKey | JLVJIBCBPJWRET-LICLKQGHSA-N |
| XLogP | 5.21 |
| TPSA | 73.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|