C27H19F2N5O4S — CID 98395285
(Z)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)prop-2-enenitrile (PubChem CID 98395285) has the molecular formula C27H19F2N5O4S and a molecular weight of 547.54 g/mol. Its IUPAC name is (Z)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 98395285 |
| Molecular Formula | C27H19F2N5O4S |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | (Z)-2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrole-3-carbonyl]-3-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C(=O)/C(C#N)=C\c2ccc(Sc3ncccn3)c([N+](=O)[O-])c2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C27H19F2N5O4S/c1-16-12-22(17(2)33(16)20-5-7-21(8-6-20)38-26(28)29)25(35)19(15-30)13-18-4-9-24(23(14-18)34(36)37)39-27-31-10-3-11-32-27/h3-14,26H,1-2H3/b19-13- |
| InChIKey | HHESJOIZKJPAMG-UYRXBGFRSA-N |
| XLogP | 6.33 |
| TPSA | 123.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|