C22H20F2N2O4 — CID 46790121
[1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-2-carboxylate (PubChem CID 46790121) has the molecular formula C22H20F2N2O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is [1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-2-carboxylate.
| Compound Name | [1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 46790121 |
| Molecular Formula | C22H20F2N2O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-1-oxopropan-2-yl] pyridine-2-carboxylate |
| SMILES | Cc1cc(C(=O)C(C)OC(=O)c2ccccn2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H20F2N2O4/c1-13-12-18(20(27)15(3)29-21(28)19-6-4-5-11-25-19)14(2)26(13)16-7-9-17(10-8-16)30-22(23)24/h4-12,15,22H,1-3H3 |
| InChIKey | STRCRCPICDESLV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|